C20H30N4O4 — CID 59065683
(2S)-N-[(3S)-7-amino-1-(benzylamino)-1,2-dioxoheptan-3-yl]-2-methylpentanediamide (PubChem CID 59065683) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2S)-N-[(3S)-7-amino-1-(benzylamino)-1,2-dioxoheptan-3-yl]-2-methylpentanediamide.
| Compound Name | (2S)-N-[(3S)-7-amino-1-(benzylamino)-1,2-dioxoheptan-3-yl]-2-methylpentanediamide |
|---|---|
| PubChem CID | 59065683 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (2S)-N-[(3S)-7-amino-1-(benzylamino)-1,2-dioxoheptan-3-yl]-2-methylpentanediamide |
| SMILES | C[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H30N4O4/c1-14(10-11-17(22)25)19(27)24-16(9-5-6-12-21)18(26)20(28)23-13-15-7-3-2-4-8-15/h2-4,7-8,14,16H,5-6,9-13,21H2,1H3,(H2,22,25)(H,23,28)(H,24,27)/t14-,16-/m0/s1 |
| InChIKey | WAGFLRLQUFMZIO-HOCLYGCPSA-N |
| XLogP | 0.39 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|