C24H27N3O9 — CID 59068424
(4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-N,6-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59068424) has the molecular formula C24H27N3O9 and a molecular weight of 501.49 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-N,6-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-N,6-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59068424 |
| Molecular Formula | C24H27N3O9 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-formamido-1,5,10,11,12a-pentahydroxy-N,6-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CNC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(NC=O)c4O)[C@H](C)[C@H]3[C@H](O)[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C24H27N3O9/c1-8-9-5-6-10(26-7-28)17(29)12(9)18(30)13-11(8)19(31)15-16(27(3)4)20(32)14(23(35)25-2)22(34)24(15,36)21(13)33/h5-8,11,15-16,19,29-31,34,36H,1-4H3,(H,25,35)(H,26,28)/t8-,11+,15+,16-,19-,24-/m0/s1 |
| InChIKey | XFCSJGXILCPBHW-ZNOJWKNNSA-N |
| XLogP | -0.68 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|