C11H13NO4 — CID 59074568
2-(hydroxymethyl)-5-methoxy-3-methyl-1H-indole-4,7-diol (PubChem CID 59074568) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-methoxy-3-methyl-1H-indole-4,7-diol.
| Compound Name | 2-(hydroxymethyl)-5-methoxy-3-methyl-1H-indole-4,7-diol |
|---|---|
| PubChem CID | 59074568 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(hydroxymethyl)-5-methoxy-3-methyl-1H-indole-4,7-diol |
| SMILES | COc1cc(O)c2[nH]c(CO)c(C)c2c1O |
| InChI | InChI=1S/C11H13NO4/c1-5-6(4-13)12-10-7(14)3-8(16-2)11(15)9(5)10/h3,12-15H,4H2,1-2H3 |
| InChIKey | CZMNXEQULHNPPI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|