C12H20NO4P — CID 59077229
(4S)-3-[(Z,2S)-2,5-dimethyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 59077229) has the molecular formula C12H20NO4P and a molecular weight of 273.27 g/mol. Its IUPAC name is (4S)-3-[(Z,2S)-2,5-dimethyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(Z,2S)-2,5-dimethyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59077229 |
| Molecular Formula | C12H20NO4P |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (4S)-3-[(Z,2S)-2,5-dimethyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C/C(=C/C[C@H](C)C(=O)N1C(=O)OC[C@@H]1C)COP |
| InChI | InChI=1S/C12H20NO4P/c1-8(6-17-18)4-5-9(2)11(14)13-10(3)7-16-12(13)15/h4,9-10H,5-7,18H2,1-3H3/b8-4-/t9-,10-/m0/s1 |
| InChIKey | XIYMLXGSDQZRNY-BBYBGLFNSA-N |
| XLogP | 2.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|