C11H18NO5P — CID 59077232
(4S)-3-[(Z,2S)-2-hydroxy-5-methyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 59077232) has the molecular formula C11H18NO5P and a molecular weight of 275.24 g/mol. Its IUPAC name is (4S)-3-[(Z,2S)-2-hydroxy-5-methyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(Z,2S)-2-hydroxy-5-methyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59077232 |
| Molecular Formula | C11H18NO5P |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (4S)-3-[(Z,2S)-2-hydroxy-5-methyl-6-phosphanyloxyhex-4-enoyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C/C(=C/C[C@H](O)C(=O)N1C(=O)OC[C@@H]1C)COP |
| InChI | InChI=1S/C11H18NO5P/c1-7(5-17-18)3-4-9(13)10(14)12-8(2)6-16-11(12)15/h3,8-9,13H,4-6,18H2,1-2H3/b7-3-/t8-,9-/m0/s1 |
| InChIKey | RVQAKGZWGHUTIB-MTMYIVCTSA-N |
| XLogP | 0.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|