C12H18O3 — CID 59086601
(2E,4E,6E)-8,8-dimethoxy-2,7-dimethylocta-2,4,6-trienal (PubChem CID 59086601) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2E,4E,6E)-8,8-dimethoxy-2,7-dimethylocta-2,4,6-trienal.
| Compound Name | (2E,4E,6E)-8,8-dimethoxy-2,7-dimethylocta-2,4,6-trienal |
|---|---|
| PubChem CID | 59086601 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2E,4E,6E)-8,8-dimethoxy-2,7-dimethylocta-2,4,6-trienal |
| SMILES | COC(OC)/C(C)=C/C=C/C=C(\C)C=O |
| InChI | InChI=1S/C12H18O3/c1-10(9-13)7-5-6-8-11(2)12(14-3)15-4/h5-9,12H,1-4H3/b6-5+,10-7+,11-8+ |
| InChIKey | KGMIJXPGPIFTCU-CQBDNMEGSA-N |
| XLogP | 2.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|