C22H33NO2 — CID 59089912
(1S,9R)-10-[(2S)-2-[(E)-but-2-enoxy]propyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol (PubChem CID 59089912) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (1S,9R)-10-[(2S)-2-[(E)-but-2-enoxy]propyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol.
| Compound Name | (1S,9R)-10-[(2S)-2-[(E)-but-2-enoxy]propyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol |
|---|---|
| PubChem CID | 59089912 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (1S,9R)-10-[(2S)-2-[(E)-but-2-enoxy]propyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol |
| SMILES | C/C=C/CO[C@@H](C)CN1CC[C@@]2(C)c3cccc(O)c3C[C@@H]1C2(C)C |
| InChI | InChI=1S/C22H33NO2/c1-6-7-13-25-16(2)15-23-12-11-22(5)18-9-8-10-19(24)17(18)14-20(23)21(22,3)4/h6-10,16,20,24H,11-15H2,1-5H3/b7-6+/t16-,20+,22-/m0/s1 |
| InChIKey | DCWMYOHRPWMMDI-HRCPZPHRSA-N |
| XLogP | 4.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|