C15H27N3O3 — CID 59094969
tert-butyl (2R,3R)-3-amino-2-(2,3-dimethylaziridine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 59094969) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-amino-2-(2,3-dimethylaziridine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-amino-2-(2,3-dimethylaziridine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59094969 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | tert-butyl (2R,3R)-3-amino-2-(2,3-dimethylaziridine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC1C(C)N1C(=O)[C@H]1[C@H](N)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O3/c1-9-10(2)18(9)13(19)12-11(16)7-6-8-17(12)14(20)21-15(3,4)5/h9-12H,6-8,16H2,1-5H3/t9?,10?,11-,12-,18?/m1/s1 |
| InChIKey | QTYROJDKOUZODZ-QTZNPIBFSA-N |
| XLogP | 1.33 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|