C27H38O4 — CID 59096047
butan-2-yl (Z)-7-[2-[(3R)-3-hydroxy-5-phenylpentyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 59096047) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is butan-2-yl (Z)-7-[2-[(3R)-3-hydroxy-5-phenylpentyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | butan-2-yl (Z)-7-[2-[(3R)-3-hydroxy-5-phenylpentyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 59096047 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | butan-2-yl (Z)-7-[2-[(3R)-3-hydroxy-5-phenylpentyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCC(C)OC(=O)CCC/C=C\CC1C(=O)C=CC1CC[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C27H38O4/c1-3-21(2)31-27(30)14-10-5-4-9-13-25-23(17-20-26(25)29)16-19-24(28)18-15-22-11-7-6-8-12-22/h4,6-9,11-12,17,20-21,23-25,28H,3,5,10,13-16,18-19H2,1-2H3/b9-4-/t21?,23?,24-,25?/m0/s1 |
| InChIKey | CKWURUQDPZLWDM-PZJAKFRPSA-N |
| XLogP | 5.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|