C28H41NO5 — CID 59097732
(4S,7R,8S,9S,11E,13Z,16S)-8-hydroxy-4,5,5,7,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 59097732) has the molecular formula C28H41NO5 and a molecular weight of 471.64 g/mol. Its IUPAC name is (4S,7R,8S,9S,11E,13Z,16S)-8-hydroxy-4,5,5,7,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,11E,13Z,16S)-8-hydroxy-4,5,5,7,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 59097732 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | (4S,7R,8S,9S,11E,13Z,16S)-8-hydroxy-4,5,5,7,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=C\C[C@@H](/C(C)=C/c2coc(C)n2)OC(=O)C[C@H](C)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)C\C=C\1 |
| InChI | InChI=1S/C28H41NO5/c1-17-10-9-11-18(2)26(31)21(5)27(32)28(7,8)20(4)15-25(30)34-24(13-12-17)19(3)14-23-16-33-22(6)29-23/h9-10,12,14,16,18,20-21,24,26,31H,11,13,15H2,1-8H3/b10-9+,17-12+,19-14+/t18-,20-,21+,24-,26-/m0/s1 |
| InChIKey | ZHLZFIJZMVYXOF-KGUMFBDRSA-N |
| XLogP | 5.85 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |