C29H45NO4S — CID 90906402
(4R,7R,8S,9S,11E,13Z,16S)-4-hydroxy-7,8,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione;propane (PubChem CID 90906402) has the molecular formula C29H45NO4S and a molecular weight of 503.75 g/mol. Its IUPAC name is (4R,7R,8S,9S,11E,13Z,16S)-4-hydroxy-7,8,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione;propane.
| Compound Name | (4R,7R,8S,9S,11E,13Z,16S)-4-hydroxy-7,8,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione;propane |
|---|---|
| PubChem CID | 90906402 |
| Molecular Formula | C29H45NO4S |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | (4R,7R,8S,9S,11E,13Z,16S)-4-hydroxy-7,8,9,13-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione;propane |
| SMILES | CC1=C\C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](O)CC(=O)[C@H](C)[C@@H](C)[C@@H](C)C\C=C\1.CCC |
| InChI | InChI=1S/C26H37NO4S.C3H8/c1-16-8-7-9-17(2)19(4)20(5)24(29)13-23(28)14-26(30)31-25(11-10-16)18(3)12-22-15-32-21(6)27-22;1-3-2/h7-8,10,12,15,17,19-20,23,25,28H,9,11,13-14H2,1-6H3;3H2,1-2H3/b8-7+,16-10+,18-12+;/t17-,19-,20+,23+,25-;/m0./s1 |
| InChIKey | XOBYXGLUUUGGJR-UFOADLMSSA-N |
| XLogP | 7.10 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |