C30H45NO3S — CID 91016806
(4S,7R,8S,9S,16S)-13-ethyl-4,5,5,7,8,9-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 91016806) has the molecular formula C30H45NO3S and a molecular weight of 499.76 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-13-ethyl-4,5,5,7,8,9-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-13-ethyl-4,5,5,7,8,9-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 91016806 |
| Molecular Formula | C30H45NO3S |
| Molecular Weight | 499.76 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | (4S,7R,8S,9S,16S)-13-ethyl-4,5,5,7,8,9-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CCC1=CC[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](C)C(C)(C)C(=O)[C@H](C)[C@@H](C)[C@@H](C)CC=C1 |
| InChI | InChI=1S/C30H45NO3S/c1-10-25-13-11-12-19(2)22(5)23(6)29(33)30(8,9)21(4)17-28(32)34-27(15-14-25)20(3)16-26-18-35-24(7)31-26/h11,13-14,16,18-19,21-23,27H,10,12,15,17H2,1-9H3/b13-11?,20-16+,25-14?/t19-,21-,22-,23+,27-/m0/s1 |
| InChIKey | WQLQJNHCBVUINQ-QQUCQHKRSA-N |
| XLogP | 7.98 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.76 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |