C20H14F3N3O — CID 59099358
3-isocyano-6-(3-methylphenyl)-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)pyridin-2-one (PubChem CID 59099358) has the molecular formula C20H14F3N3O and a molecular weight of 369.35 g/mol. Its IUPAC name is 3-isocyano-6-(3-methylphenyl)-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-isocyano-6-(3-methylphenyl)-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59099358 |
| Molecular Formula | C20H14F3N3O |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-isocyano-6-(3-methylphenyl)-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2cccc(C)c2)n(Cc2cccnc2)c1=O |
| InChI | InChI=1S/C20H14F3N3O/c1-13-5-3-7-15(9-13)17-10-16(20(21,22)23)18(24-2)19(27)26(17)12-14-6-4-8-25-11-14/h3-11H,12H2,1H3 |
| InChIKey | ZTZGLQGUVQQJPQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|