C21H15BrF3N3O — CID 59726752
6-(4-bromophenyl)-1-[(2,6-dimethyl-3-pyridinyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one (PubChem CID 59726752) has the molecular formula C21H15BrF3N3O and a molecular weight of 462.27 g/mol. Its IUPAC name is 6-(4-bromophenyl)-1-[(2,6-dimethyl-3-pyridinyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 6-(4-bromophenyl)-1-[(2,6-dimethyl-3-pyridinyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59726752 |
| Molecular Formula | C21H15BrF3N3O |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 6-(4-bromophenyl)-1-[(2,6-dimethyl-3-pyridinyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2ccc(Br)cc2)n(Cc2ccc(C)nc2C)c1=O |
| InChI | InChI=1S/C21H15BrF3N3O/c1-12-4-5-15(13(2)27-12)11-28-18(14-6-8-16(22)9-7-14)10-17(21(23,24)25)19(26-3)20(28)29/h4-10H,11H2,1-2H3 |
| InChIKey | GTDTZSPYWPLZOC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|