C23H18F3N3O3 — CID 88910373
[3-[1-benzyl-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenyl] N-ethylcarbamate (PubChem CID 88910373) has the molecular formula C23H18F3N3O3 and a molecular weight of 441.41 g/mol. Its IUPAC name is [3-[1-benzyl-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenyl] N-ethylcarbamate.
| Compound Name | [3-[1-benzyl-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 88910373 |
| Molecular Formula | C23H18F3N3O3 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [3-[1-benzyl-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenyl] N-ethylcarbamate |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2cccc(OC(=O)NCC)c2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H18F3N3O3/c1-3-28-22(31)32-17-11-7-10-16(12-17)19-13-18(23(24,25)26)20(27-2)21(30)29(19)14-15-8-5-4-6-9-15/h4-13H,3,14H2,1H3,(H,28,31) |
| InChIKey | CTZXRGIODBEWCQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|