C20H27NO5 — CID 59100067
(8R,9S,9aS,9bS)-9-hydroxy-2,2-dimethyl-8-(2-phenylmethoxyethyl)-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one (PubChem CID 59100067) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (8R,9S,9aS,9bS)-9-hydroxy-2,2-dimethyl-8-(2-phenylmethoxyethyl)-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one.
| Compound Name | (8R,9S,9aS,9bS)-9-hydroxy-2,2-dimethyl-8-(2-phenylmethoxyethyl)-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
|---|---|
| PubChem CID | 59100067 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (8R,9S,9aS,9bS)-9-hydroxy-2,2-dimethyl-8-(2-phenylmethoxyethyl)-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
| SMILES | CC1(C)OC2CN3C(=O)C[C@@H](CCOCc4ccccc4)[C@H](O)[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C20H27NO5/c1-20(2)25-15-11-21-16(22)10-14(18(23)17(21)19(15)26-20)8-9-24-12-13-6-4-3-5-7-13/h3-7,14-15,17-19,23H,8-12H2,1-2H3/t14-,15?,17+,18+,19-/m1/s1 |
| InChIKey | OHVZCTIYCFXWRG-UPIITLFSSA-N |
| XLogP | 1.71 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|