C10H20N2 — CID 59110309
2-N-methyl-3-methylidene-1-N-prop-2-enylpentane-1,2-diamine (PubChem CID 59110309) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-N-methyl-3-methylidene-1-N-prop-2-enylpentane-1,2-diamine.
| Compound Name | 2-N-methyl-3-methylidene-1-N-prop-2-enylpentane-1,2-diamine |
|---|---|
| PubChem CID | 59110309 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-N-methyl-3-methylidene-1-N-prop-2-enylpentane-1,2-diamine |
| SMILES | C=CCNCC(NC)C(=C)CC |
| InChI | InChI=1S/C10H20N2/c1-5-7-12-8-10(11-4)9(3)6-2/h5,10-12H,1,3,6-8H2,2,4H3 |
| InChIKey | WHXQRKLSRQSSOI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|