C28H29Cl2N3O5 — CID 59116728
2-[5,5-bis[3-chloro-5-(4,5-dihydro-1,3-oxazol-2-yl)-4-methoxyphenyl]pent-4-enyl]-4,5-dihydro-1,3-oxazole (PubChem CID 59116728) has the molecular formula C28H29Cl2N3O5 and a molecular weight of 558.46 g/mol. Its IUPAC name is 2-[5,5-bis[3-chloro-5-(4,5-dihydro-1,3-oxazol-2-yl)-4-methoxyphenyl]pent-4-enyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[5,5-bis[3-chloro-5-(4,5-dihydro-1,3-oxazol-2-yl)-4-methoxyphenyl]pent-4-enyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 59116728 |
| Molecular Formula | C28H29Cl2N3O5 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | 2-[5,5-bis[3-chloro-5-(4,5-dihydro-1,3-oxazol-2-yl)-4-methoxyphenyl]pent-4-enyl]-4,5-dihydro-1,3-oxazole |
| SMILES | COc1c(Cl)cc(C(=CCCCC2=NCCO2)c2cc(Cl)c(OC)c(C3=NCCO3)c2)cc1C1=NCCO1 |
| InChI | InChI=1S/C28H29Cl2N3O5/c1-34-25-20(27-32-8-11-37-27)13-17(15-22(25)29)19(5-3-4-6-24-31-7-10-36-24)18-14-21(28-33-9-12-38-28)26(35-2)23(30)16-18/h5,13-16H,3-4,6-12H2,1-2H3 |
| InChIKey | DYMCWIXLOUCNAI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|