C17H34OSi — CID 59121124
(3,4-dimethylcyclopentyl)oxy-dimethyl-oct-7-enylsilane (PubChem CID 59121124) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is (3,4-dimethylcyclopentyl)oxy-dimethyl-oct-7-enylsilane.
| Compound Name | (3,4-dimethylcyclopentyl)oxy-dimethyl-oct-7-enylsilane |
|---|---|
| PubChem CID | 59121124 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (3,4-dimethylcyclopentyl)oxy-dimethyl-oct-7-enylsilane |
| SMILES | C=CCCCCCC[Si](C)(C)OC1CC(C)C(C)C1 |
| InChI | InChI=1S/C17H34OSi/c1-6-7-8-9-10-11-12-19(4,5)18-17-13-15(2)16(3)14-17/h6,15-17H,1,7-14H2,2-5H3 |
| InChIKey | BGJHCKFDDSRATP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|