C22H27FN4O2S — CID 59121878
1-(3-fluorophenyl)-3-[4-[4-(6-methylthieno[2,3-d][1,2]oxazol-3-yl)piperidin-1-yl]butyl]urea (PubChem CID 59121878) has the molecular formula C22H27FN4O2S and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[4-[4-(6-methylthieno[2,3-d][1,2]oxazol-3-yl)piperidin-1-yl]butyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[4-[4-(6-methylthieno[2,3-d][1,2]oxazol-3-yl)piperidin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 59121878 |
| Molecular Formula | C22H27FN4O2S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[4-[4-(6-methylthieno[2,3-d][1,2]oxazol-3-yl)piperidin-1-yl]butyl]urea |
| SMILES | Cc1csc2c(C3CCN(CCCCNC(=O)Nc4cccc(F)c4)CC3)noc12 |
| InChI | InChI=1S/C22H27FN4O2S/c1-15-14-30-21-19(26-29-20(15)21)16-7-11-27(12-8-16)10-3-2-9-24-22(28)25-18-6-4-5-17(23)13-18/h4-6,13-14,16H,2-3,7-12H2,1H3,(H2,24,25,28) |
| InChIKey | OTVQALAVRVLCCF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|