C22H21N3O — CID 59123579
(2Z)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-2H-pyran-5-ylidene]-2-isocyanoacetonitrile (PubChem CID 59123579) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is (2Z)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-2H-pyran-5-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-2H-pyran-5-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 59123579 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2Z)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-2H-pyran-5-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C(/C=C/c2cc3c4c(c2)CCCN4CCC3)COC1 |
| InChI | InChI=1S/C22H21N3O/c1-24-21(13-23)20-12-17(14-26-15-20)7-6-16-10-18-4-2-8-25-9-3-5-19(11-16)22(18)25/h6-7,10-12H,2-5,8-9,14-15H2/b7-6+,21-20- |
| InChIKey | QUMDZTHAYKKMMI-SPPJIQIJSA-N |
| XLogP | 4.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|