C25H23N3 — CID 123713956
(2E)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-5-ethenylcyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 123713956) has the molecular formula C25H23N3 and a molecular weight of 365.48 g/mol. Its IUPAC name is (2E)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-5-ethenylcyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-5-ethenylcyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 123713956 |
| Molecular Formula | C25H23N3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2E)-2-[3-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-5-ethenylcyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(C=C)CC(/C=C/c2cc3c4c(c2)CCCN4CCC3)=C1 |
| InChI | InChI=1S/C25H23N3/c1-3-18-12-19(16-23(13-18)24(17-26)27-2)8-9-20-14-21-6-4-10-28-11-5-7-22(15-20)25(21)28/h3,8-9,13-16H,1,4-7,10-12H2/b9-8+,24-23+ |
| InChIKey | AXCXSQAMINDGMQ-FXABLKCNSA-N |
| XLogP | 5.54 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|