C24H33F3N6O4S2 — CID 59126664
2-methylpropyl 5-[[2-methyl-1-pentyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126664) has the molecular formula C24H33F3N6O4S2 and a molecular weight of 590.69 g/mol. Its IUPAC name is 2-methylpropyl 5-[[2-methyl-1-pentyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 2-methylpropyl 5-[[2-methyl-1-pentyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126664 |
| Molecular Formula | C24H33F3N6O4S2 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2-methylpropyl 5-[[2-methyl-1-pentyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCCCN1c2cc(NS(=O)(=O)CC(F)(F)F)c(/N=N/c3nnc(C(=O)OCC(C)C)s3)cc2CCC1C |
| InChI | InChI=1S/C24H33F3N6O4S2/c1-5-6-7-10-33-16(4)8-9-17-11-18(19(12-20(17)33)32-39(35,36)14-24(25,26)27)28-30-23-31-29-21(38-23)22(34)37-13-15(2)3/h11-12,15-16,32H,5-10,13-14H2,1-4H3/b30-28+ |
| InChIKey | VMRSVFXXTKRTEA-SJCQXOIGSA-N |
| XLogP | 6.40 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|