C22H29F3N6O5S2 — CID 59126473
2-methoxyethyl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126473) has the molecular formula C22H29F3N6O5S2 and a molecular weight of 578.64 g/mol. Its IUPAC name is 2-methoxyethyl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 2-methoxyethyl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126473 |
| Molecular Formula | C22H29F3N6O5S2 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 2-methoxyethyl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCCCN1c2cc(NS(=O)(=O)C(F)(F)F)c(/N=N/c3nnc(C(=O)OCCOC)s3)cc2CCC1C |
| InChI | InChI=1S/C22H29F3N6O5S2/c1-4-5-6-9-31-14(2)7-8-15-12-16(17(13-18(15)31)30-38(33,34)22(23,24)25)26-28-21-29-27-19(37-21)20(32)36-11-10-35-3/h12-14,30H,4-11H2,1-3H3/b28-26+ |
| InChIKey | VPKITMOEIHMBBL-BYCLXTJYSA-N |
| XLogP | 5.35 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|