C21H27F3N6O5S2 — CID 59126654
2-methoxyethyl 5-[[2-methyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126654) has the molecular formula C21H27F3N6O5S2 and a molecular weight of 564.61 g/mol. Its IUPAC name is 2-methoxyethyl 5-[[2-methyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 2-methoxyethyl 5-[[2-methyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126654 |
| Molecular Formula | C21H27F3N6O5S2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 2-methoxyethyl 5-[[2-methyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | COCCOC(=O)c1nnc(/N=N/c2cc3c(cc2NS(=O)(=O)CC(F)(F)F)N(C(C)C)C(C)CC3)s1 |
| InChI | InChI=1S/C21H27F3N6O5S2/c1-12(2)30-13(3)5-6-14-9-15(16(10-17(14)30)29-37(32,33)11-21(22,23)24)25-27-20-28-26-18(36-20)19(31)35-8-7-34-4/h9-10,12-13,29H,5-8,11H2,1-4H3/b27-25+ |
| InChIKey | RBGWBGRHSLOXJO-IMVLJIQESA-N |
| XLogP | 4.61 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|