C20H25F3N6O4S2 — CID 59126503
2-methylpropyl 5-[[1-ethyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126503) has the molecular formula C20H25F3N6O4S2 and a molecular weight of 534.59 g/mol. Its IUPAC name is 2-methylpropyl 5-[[1-ethyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 2-methylpropyl 5-[[1-ethyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126503 |
| Molecular Formula | C20H25F3N6O4S2 |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 2-methylpropyl 5-[[1-ethyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCN1CCCc2cc(/N=N/c3nnc(C(=O)OCC(C)C)s3)c(NS(=O)(=O)CC(F)(F)F)cc21 |
| InChI | InChI=1S/C20H25F3N6O4S2/c1-4-29-7-5-6-13-8-14(15(9-16(13)29)28-35(31,32)11-20(21,22)23)24-26-19-27-25-17(34-19)18(30)33-10-12(2)3/h8-9,12,28H,4-7,10-11H2,1-3H3/b26-24+ |
| InChIKey | MAVMNWGJIMKKOS-SHHOIMCASA-N |
| XLogP | 4.84 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|