C19H23F3N6O4S2 — CID 59126725
tert-butyl 5-[[1-ethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126725) has the molecular formula C19H23F3N6O4S2 and a molecular weight of 520.56 g/mol. Its IUPAC name is tert-butyl 5-[[1-ethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | tert-butyl 5-[[1-ethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126725 |
| Molecular Formula | C19H23F3N6O4S2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | tert-butyl 5-[[1-ethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCN1CCCc2cc(/N=N/c3nnc(C(=O)OC(C)(C)C)s3)c(NS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H23F3N6O4S2/c1-5-28-8-6-7-11-9-12(13(10-14(11)28)27-34(30,31)19(20,21)22)23-25-17-26-24-15(33-17)16(29)32-18(2,3)4/h9-10,27H,5-8H2,1-4H3/b25-23+ |
| InChIKey | DQNFRCRXQVWXJS-WJTDDFOZSA-N |
| XLogP | 4.94 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|