C20H25F3N6O4S2 — CID 59126448
tert-butyl 5-[[1-propan-2-yl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126448) has the molecular formula C20H25F3N6O4S2 and a molecular weight of 534.59 g/mol. Its IUPAC name is tert-butyl 5-[[1-propan-2-yl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | tert-butyl 5-[[1-propan-2-yl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126448 |
| Molecular Formula | C20H25F3N6O4S2 |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | tert-butyl 5-[[1-propan-2-yl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CC(C)N1CCCc2cc(/N=N/c3nnc(C(=O)OC(C)(C)C)s3)c(NS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C20H25F3N6O4S2/c1-11(2)29-8-6-7-12-9-13(14(10-15(12)29)28-35(31,32)20(21,22)23)24-26-18-27-25-16(34-18)17(30)33-19(3,4)5/h9-11,28H,6-8H2,1-5H3/b26-24+ |
| InChIKey | HRMFXTJBQFKEMY-SHHOIMCASA-N |
| XLogP | 5.33 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|