C27H29Cl3N4O4S — CID 59134215
6-[(3-chlorophenyl)methyl]-8-cyclopropyl-1-(2,4-dichlorophenyl)sulfonyl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 59134215) has the molecular formula C27H29Cl3N4O4S and a molecular weight of 611.98 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methyl]-8-cyclopropyl-1-(2,4-dichlorophenyl)sulfonyl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 6-[(3-chlorophenyl)methyl]-8-cyclopropyl-1-(2,4-dichlorophenyl)sulfonyl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59134215 |
| Molecular Formula | C27H29Cl3N4O4S |
| Molecular Weight | 611.98 g/mol |
| Exact Mass | 610.10 |
| IUPAC Name | 6-[(3-chlorophenyl)methyl]-8-cyclopropyl-1-(2,4-dichlorophenyl)sulfonyl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | O=C1C(Cc2cccc(Cl)c2)N2C(=O)C(N3CCCC3)CN(S(=O)(=O)c3ccc(Cl)cc3Cl)C2CN1C1CC1 |
| InChI | InChI=1S/C27H29Cl3N4O4S/c28-18-5-3-4-17(12-18)13-22-26(35)32(20-7-8-20)16-25-33(39(37,38)24-9-6-19(29)14-21(24)30)15-23(27(36)34(22)25)31-10-1-2-11-31/h3-6,9,12,14,20,22-23,25H,1-2,7-8,10-11,13,15-16H2 |
| InChIKey | CRHMSJKFXHOCEL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.98 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |