C27H31Cl3N4O4S — CID 59134117
6-[(3-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 59134117) has the molecular formula C27H31Cl3N4O4S and a molecular weight of 614.00 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 6-[(3-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59134117 |
| Molecular Formula | C27H31Cl3N4O4S |
| Molecular Weight | 614.00 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | 6-[(3-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)C(N3CCCC3)CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C27H31Cl3N4O4S/c1-17(2)32-16-25-33(39(37,38)24-9-8-20(29)14-21(24)30)15-23(31-10-3-4-11-31)27(36)34(25)22(26(32)35)13-18-6-5-7-19(28)12-18/h5-9,12,14,17,22-23,25H,3-4,10-11,13,15-16H2,1-2H3 |
| InChIKey | QIACHPCLYFHGOC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.00 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |