C28H33Cl2FN4O4S — CID 59134046
1-(2,4-dichlorophenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-3-piperidin-1-yl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 59134046) has the molecular formula C28H33Cl2FN4O4S and a molecular weight of 611.57 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-3-piperidin-1-yl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 1-(2,4-dichlorophenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-3-piperidin-1-yl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59134046 |
| Molecular Formula | C28H33Cl2FN4O4S |
| Molecular Weight | 611.57 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 1-(2,4-dichlorophenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-3-piperidin-1-yl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)C(N3CCCCC3)CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C28H33Cl2FN4O4S/c1-18(2)33-17-26-34(40(38,39)25-11-8-20(29)15-22(25)30)16-24(32-12-4-3-5-13-32)28(37)35(26)23(27(33)36)14-19-6-9-21(31)10-7-19/h6-11,15,18,23-24,26H,3-5,12-14,16-17H2,1-2H3 |
| InChIKey | YQJUDMXOWGWTHV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |