C24H27ClFN3O5S — CID 59735195
1-(5-chloro-2-methoxyphenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 59735195) has the molecular formula C24H27ClFN3O5S and a molecular weight of 524.01 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59735195 |
| Molecular Formula | C24H27ClFN3O5S |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-6-[(4-fluorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCC(=O)N2C(Cc3ccc(F)cc3)C(=O)N(C(C)C)CC21 |
| InChI | InChI=1S/C24H27ClFN3O5S/c1-15(2)27-14-22-28(35(32,33)21-13-17(25)6-9-20(21)34-3)11-10-23(30)29(22)19(24(27)31)12-16-4-7-18(26)8-5-16/h4-9,13,15,19,22H,10-12,14H2,1-3H3 |
| InChIKey | MEKCIIBPSGUAJR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |