C24H27Cl2N3O5S — CID 59735236
1-(5-chloro-2-methoxyphenyl)sulfonyl-5-[(4-chlorophenyl)methyl]-2-methyl-7-propan-2-yl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione (PubChem CID 59735236) has the molecular formula C24H27Cl2N3O5S and a molecular weight of 540.47 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-5-[(4-chlorophenyl)methyl]-2-methyl-7-propan-2-yl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-5-[(4-chlorophenyl)methyl]-2-methyl-7-propan-2-yl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
|---|---|
| PubChem CID | 59735236 |
| Molecular Formula | C24H27Cl2N3O5S |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-5-[(4-chlorophenyl)methyl]-2-methyl-7-propan-2-yl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1C(C)C(=O)N2C(Cc3ccc(Cl)cc3)C(=O)N(C(C)C)CC21 |
| InChI | InChI=1S/C24H27Cl2N3O5S/c1-14(2)27-13-22-28(19(24(27)31)11-16-5-7-17(25)8-6-16)23(30)15(3)29(22)35(32,33)21-12-18(26)9-10-20(21)34-4/h5-10,12,14-15,19,22H,11,13H2,1-4H3 |
| InChIKey | GXEDVBIEEZJFBI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |