C23H28N5O5+ — CID 59134518
[(1R,2R)-3-(1,3-dihydroisoindol-2-yl)-1,2-dihydroxy-3-oxopropyl]-[2-[3-(2-methylphenyl)-2-oxoimidazolidin-1-yl]ethylamino]-oxoazanium (PubChem CID 59134518) has the molecular formula C23H28N5O5+ and a molecular weight of 454.51 g/mol. Its IUPAC name is [(1R,2R)-3-(1,3-dihydroisoindol-2-yl)-1,2-dihydroxy-3-oxopropyl]-[2-[3-(2-methylphenyl)-2-oxoimidazolidin-1-yl]ethylamino]-oxoazanium.
| Compound Name | [(1R,2R)-3-(1,3-dihydroisoindol-2-yl)-1,2-dihydroxy-3-oxopropyl]-[2-[3-(2-methylphenyl)-2-oxoimidazolidin-1-yl]ethylamino]-oxoazanium |
|---|---|
| PubChem CID | 59134518 |
| Molecular Formula | C23H28N5O5+ |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [(1R,2R)-3-(1,3-dihydroisoindol-2-yl)-1,2-dihydroxy-3-oxopropyl]-[2-[3-(2-methylphenyl)-2-oxoimidazolidin-1-yl]ethylamino]-oxoazanium |
| SMILES | Cc1ccccc1N1CCN(CCN[N+](=O)[C@H](O)[C@@H](O)C(=O)N2Cc3ccccc3C2)C1=O |
| InChI | InChI=1S/C23H28N5O5/c1-16-6-2-5-9-19(16)27-13-12-25(23(27)32)11-10-24-28(33)22(31)20(29)21(30)26-14-17-7-3-4-8-18(17)15-26/h2-9,20,22,29,31H,10-15H2,1H3,(H,24,33)/q+1/t20-,22+/m0/s1 |
| InChIKey | GFUMQFKQFJTASZ-RBBKRZOGSA-N |
| XLogP | 0.74 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|