C41H99Br7O20Si17 — CID 59138448
CID 59138448 (PubChem CID 59138448) has the molecular formula C41H99Br7O20Si17 and a molecular weight of 1949.01 g/mol.
| Compound Name | CID 59138448 |
|---|---|
| PubChem CID | 59138448 |
| Molecular Formula | C41H99Br7O20Si17 |
| Molecular Weight | 1949.01 g/mol |
| Exact Mass | 1939.71 |
| IUPAC Name | — |
| SMILES | CCCC[Si](C)(C)O[Si]O[Si]1(O[Si](C)(C)CCCBr)O[Si]2(O[Si](C)(C)CCCBr)O[Si]3(O[Si](C)(C)CCCBr)O[Si]O[Si]4(O[Si](C)(C)CCCBr)O[Si](O[Si](C)(C)CCCBr)(O1)O[Si](O[Si](C)(C)CCCBr)(O2)O[Si](O[Si](C)(C)CCCBr)(O3)O4 |
| InChI | InChI=1S/C41H99Br7O20Si17/c1-18-19-34-71(2,3)49-69-50-79(53-72(4,5)35-20-27-42)60-82(56-75(10,11)38-23-30-45)62-80(54-73(6,7)36-21-28-43)51-70-52-81(55-74(8,9)37-22-29-44)63-83(61-79,57-76(12,13)39-24-31-46)67-85(66-82,59-78(16,17)41-26-33-48)68-84(64-80,65-81)58-77(14,15)40-25-32-47/h18-41H2,1-17H3 |
| InChIKey | RBZVLJGWIHLEDN-UHFFFAOYSA-N |
| XLogP | 15.43 |
| TPSA | 184.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1949.01 |
| LogP ≤ 5 | 15.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|