C19H48O13Si9 — CID 91476600
(3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)oxy-dimethyl-propylsilane (PubChem CID 91476600) has the molecular formula C19H48O13Si9 and a molecular weight of 737.35 g/mol. Its IUPAC name is (3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)oxy-dimethyl-propylsilane.
| Compound Name | (3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)oxy-dimethyl-propylsilane |
|---|---|
| PubChem CID | 91476600 |
| Molecular Formula | C19H48O13Si9 |
| Molecular Weight | 737.35 g/mol |
| Exact Mass | 736.10 |
| IUPAC Name | (3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)oxy-dimethyl-propylsilane |
| SMILES | CCC[Si](C)(C)O[Si]12O[Si]3(CC)O[Si]4(CC)O[Si]5(CC)O[Si](CC)(O3)O[Si](CC)(O[Si](CC)(O5)O[Si](CC)(O4)O1)O2 |
| InChI | InChI=1S/C19H48O13Si9/c1-11-19-33(9,10)20-41-30-38(16-6)24-35(13-3)21-34(12-2)22-36(14-4,26-38)28-40(18-8,32-41)29-37(15-5,23-34)27-39(17-7,25-35)31-41/h11-19H2,1-10H3 |
| InChIKey | QTRCDEBNRMNAND-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|