C19H29N7O2 — CID 59144900
1-ethyl-3-methyl-6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butylamino]pyrimidine-2,4-dione (PubChem CID 59144900) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 1-ethyl-3-methyl-6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butylamino]pyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-methyl-6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butylamino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59144900 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 1-ethyl-3-methyl-6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butylamino]pyrimidine-2,4-dione |
| SMILES | CCn1c(NCCCCN2CCN(c3ncccn3)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H29N7O2/c1-3-26-16(15-17(27)23(2)19(26)28)20-7-4-5-10-24-11-13-25(14-12-24)18-21-8-6-9-22-18/h6,8-9,15,20H,3-5,7,10-14H2,1-2H3 |
| InChIKey | PXRMQODBTQMLFI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|