C19H24N2O — CID 59152791
[1-benzyl-2,2,3,3,5,5,6,6-octadeuterio-4-(2,3,4,5,6-pentadeuterioanilino)piperidin-4-yl]-dideuteriomethanol (PubChem CID 59152791) has the molecular formula C19H24N2O and a molecular weight of 311.51 g/mol. Its IUPAC name is [1-benzyl-2,2,3,3,5,5,6,6-octadeuterio-4-(2,3,4,5,6-pentadeuterioanilino)piperidin-4-yl]-dideuteriomethanol.
| Compound Name | [1-benzyl-2,2,3,3,5,5,6,6-octadeuterio-4-(2,3,4,5,6-pentadeuterioanilino)piperidin-4-yl]-dideuteriomethanol |
|---|---|
| PubChem CID | 59152791 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | [1-benzyl-2,2,3,3,5,5,6,6-octadeuterio-4-(2,3,4,5,6-pentadeuterioanilino)piperidin-4-yl]-dideuteriomethanol |
| SMILES | [2H]c1c([2H])c([2H])c(NC2(C([2H])([2H])O)C([2H])([2H])C([2H])([2H])N(Cc3ccccc3)C([2H])([2H])C2([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C19H24N2O/c22-16-19(20-18-9-5-2-6-10-18)11-13-21(14-12-19)15-17-7-3-1-4-8-17/h1-10,20,22H,11-16H2/i2D,5D,6D,9D,10D,11D2,12D2,13D2,14D2,16D2 |
| InChIKey | WTOYUGZUPNQZHG-PBYSQWLWSA-N |
| XLogP | 3.13 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |