C18H22N2 — CID 59152780
1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)piperidin-4-amine (PubChem CID 59152780) has the molecular formula C18H22N2 and a molecular weight of 280.47 g/mol. Its IUPAC name is 1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)piperidin-4-amine.
| Compound Name | 1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 59152780 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 280.47 g/mol |
| Exact Mass | 280.27 |
| IUPAC Name | 1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)piperidin-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c(NC2([2H])C([2H])([2H])C([2H])([2H])N(Cc3ccccc3)C([2H])([2H])C2([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C18H22N2/c1-3-7-16(8-4-1)15-20-13-11-18(12-14-20)19-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2/i2D,5D,6D,9D,10D,11D2,12D2,13D2,14D2,18D |
| InChIKey | FSXGJIFBTBJMHV-SZSWHXAWSA-N |
| XLogP | 3.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |