C16H23NO7S — CID 59153255
[(5R,6S,7R)-6,7-diacetyloxy-2-propyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 59153255) has the molecular formula C16H23NO7S and a molecular weight of 373.43 g/mol. Its IUPAC name is [(5R,6S,7R)-6,7-diacetyloxy-2-propyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [(5R,6S,7R)-6,7-diacetyloxy-2-propyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 59153255 |
| Molecular Formula | C16H23NO7S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [(5R,6S,7R)-6,7-diacetyloxy-2-propyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | CCCC1=NC2C(O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)S1 |
| InChI | InChI=1S/C16H23NO7S/c1-5-6-12-17-13-15(23-10(4)20)14(22-9(3)19)11(7-21-8(2)18)24-16(13)25-12/h11,13-16H,5-7H2,1-4H3/t11-,13?,14-,15-,16?/m1/s1 |
| InChIKey | VRJFQCRQLPVYQE-SMCUARQCSA-N |
| XLogP | 1.45 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|