C13H21NO4S — CID 71105179
[(3aR,5S,6S,7S,7aR)-2-(methoxymethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 71105179) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is [(3aR,5S,6S,7S,7aR)-2-(methoxymethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [(3aR,5S,6S,7S,7aR)-2-(methoxymethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 71105179 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [(3aR,5S,6S,7S,7aR)-2-(methoxymethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | COCC1=N[C@@H]2[C@@H](C)[C@H](C)[C@@H](COC(C)=O)O[C@@H]2S1 |
| InChI | InChI=1S/C13H21NO4S/c1-7-8(2)12-13(19-11(14-12)6-16-4)18-10(7)5-17-9(3)15/h7-8,10,12-13H,5-6H2,1-4H3/t7-,8-,10+,12+,13+/m0/s1 |
| InChIKey | FTQMAJQGEKKKTF-LOGDQGEYSA-N |
| XLogP | 1.71 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |