C12H17F2NO3S — CID 71105174
[(3aR,5S,6S,7S,7aR)-2-(difluoromethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 71105174) has the molecular formula C12H17F2NO3S and a molecular weight of 293.34 g/mol. Its IUPAC name is [(3aR,5S,6S,7S,7aR)-2-(difluoromethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [(3aR,5S,6S,7S,7aR)-2-(difluoromethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 71105174 |
| Molecular Formula | C12H17F2NO3S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [(3aR,5S,6S,7S,7aR)-2-(difluoromethyl)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2SC(C(F)F)=N[C@@H]2[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H17F2NO3S/c1-5-6(2)9-12(19-11(15-9)10(13)14)18-8(5)4-17-7(3)16/h5-6,8-10,12H,4H2,1-3H3/t5-,6-,8+,9+,12+/m0/s1 |
| InChIKey | UZEGMYUDDQTIJZ-QRSDYGCRSA-N |
| XLogP | 2.33 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |