C12H19NO4S — CID 71105236
[(3aR,5S,6S,7S,7aR)-2-methoxy-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 71105236) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is [(3aR,5S,6S,7S,7aR)-2-methoxy-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [(3aR,5S,6S,7S,7aR)-2-methoxy-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 71105236 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [(3aR,5S,6S,7S,7aR)-2-methoxy-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | COC1=N[C@@H]2[C@@H](C)[C@H](C)[C@@H](COC(C)=O)O[C@@H]2S1 |
| InChI | InChI=1S/C12H19NO4S/c1-6-7(2)10-11(18-12(13-10)15-4)17-9(6)5-16-8(3)14/h6-7,9-11H,5H2,1-4H3/t6-,7-,9+,10+,11+/m0/s1 |
| InChIKey | GDHAUJOLDUDKDD-GOIIVKRLSA-N |
| XLogP | 1.66 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |