C28H50O6P2S2Sn — CID 59155865
tributyl-[4-diethoxyphosphoryl-5-(3-diethoxyphosphorylthiophen-2-yl)thiophen-2-yl]stannane (PubChem CID 59155865) has the molecular formula C28H50O6P2S2Sn and a molecular weight of 727.50 g/mol. Its IUPAC name is tributyl-[4-diethoxyphosphoryl-5-(3-diethoxyphosphorylthiophen-2-yl)thiophen-2-yl]stannane.
| Compound Name | tributyl-[4-diethoxyphosphoryl-5-(3-diethoxyphosphorylthiophen-2-yl)thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 59155865 |
| Molecular Formula | C28H50O6P2S2Sn |
| Molecular Weight | 727.50 g/mol |
| Exact Mass | 728.15 |
| IUPAC Name | tributyl-[4-diethoxyphosphoryl-5-(3-diethoxyphosphorylthiophen-2-yl)thiophen-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(P(=O)(OCC)OCC)c(-c2sccc2P(=O)(OCC)OCC)s1 |
| InChI | InChI=1S/C16H23O6P2S2.3C4H9.Sn/c1-5-19-23(17,20-6-2)13-9-11-25-15(13)16-14(10-12-26-16)24(18,21-7-3)22-8-4;3*1-3-4-2;/h9-11H,5-8H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | KWIXGNMBXOGSBZ-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.50 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|