C36H46O6P2S5 — CID 59155893
3,4-bis(dibutoxyphosphoryl)-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene (PubChem CID 59155893) has the molecular formula C36H46O6P2S5 and a molecular weight of 797.04 g/mol. Its IUPAC name is 3,4-bis(dibutoxyphosphoryl)-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene.
| Compound Name | 3,4-bis(dibutoxyphosphoryl)-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 59155893 |
| Molecular Formula | C36H46O6P2S5 |
| Molecular Weight | 797.04 g/mol |
| Exact Mass | 796.14 |
| IUPAC Name | 3,4-bis(dibutoxyphosphoryl)-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene |
| SMILES | CCCCOP(=O)(OCCCC)c1c(-c2ccc(-c3cccs3)s2)sc(-c2ccc(-c3cccs3)s2)c1P(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C36H46O6P2S5/c1-5-9-21-39-43(37,40-22-10-6-2)33-34(44(38,41-23-11-7-3)42-24-12-8-4)36(32-20-18-30(48-32)28-16-14-26-46-28)49-35(33)31-19-17-29(47-31)27-15-13-25-45-27/h13-20,25-26H,5-12,21-24H2,1-4H3 |
| InChIKey | VZLDQCPMVREUCH-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.04 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|