C7H10N2S2 — CID 59156475
4-(1,3-thiazol-2-yl)thiomorpholine (PubChem CID 59156475) has the molecular formula C7H10N2S2 and a molecular weight of 186.31 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)thiomorpholine.
| Compound Name | 4-(1,3-thiazol-2-yl)thiomorpholine |
|---|---|
| PubChem CID | 59156475 |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.31 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)thiomorpholine |
| SMILES | c1csc(N2CCSCC2)n1 |
| InChI | InChI=1S/C7H10N2S2/c1-4-11-7(8-1)9-2-5-10-6-3-9/h1,4H,2-3,5-6H2 |
| InChIKey | HWOBGNPVBGEDKG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |