C2ClF6N2O5PS2-2 — CID 59188252
[chloro(trifluoromethylsulfonylazanidyl)phosphoryl]-(trifluoromethylsulfonyl)azanide (PubChem CID 59188252) has the molecular formula C2ClF6N2O5PS2-2 and a molecular weight of 376.58 g/mol. Its IUPAC name is [chloro(trifluoromethylsulfonylazanidyl)phosphoryl]-(trifluoromethylsulfonyl)azanide.
| Compound Name | [chloro(trifluoromethylsulfonylazanidyl)phosphoryl]-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 59188252 |
| Molecular Formula | C2ClF6N2O5PS2-2 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 375.86 |
| IUPAC Name | [chloro(trifluoromethylsulfonylazanidyl)phosphoryl]-(trifluoromethylsulfonyl)azanide |
| SMILES | O=P(Cl)([N-]S(=O)(=O)C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C2ClF6N2O5PS2/c3-17(12,10-18(13,14)1(4,5)6)11-19(15,16)2(7,8)9/q-2 |
| InChIKey | POZIPWAJERENFW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|