C15H8ClF5N2O — CID 59192646
2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetonitrile (PubChem CID 59192646) has the molecular formula C15H8ClF5N2O and a molecular weight of 362.69 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetonitrile.
| Compound Name | 2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 59192646 |
| Molecular Formula | C15H8ClF5N2O |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetonitrile |
| SMILES | N#CC(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H8ClF5N2O/c16-9-1-2-13(23-7-9)12(6-22)8-3-10(17)5-11(4-8)24-15(20,21)14(18)19/h1-5,7,12,14H |
| InChIKey | JVCVTESFEWNMQT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|