C26H20F3N3O — CID 59193739
N-(2-cyanoethyl)-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1H-indol-7-yl]benzamide (PubChem CID 59193739) has the molecular formula C26H20F3N3O and a molecular weight of 447.46 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1H-indol-7-yl]benzamide.
| Compound Name | N-(2-cyanoethyl)-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1H-indol-7-yl]benzamide |
|---|---|
| PubChem CID | 59193739 |
| Molecular Formula | C26H20F3N3O |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-(2-cyanoethyl)-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1H-indol-7-yl]benzamide |
| SMILES | N#CCCNC(=O)c1cccc(-c2cccc3cc(Cc4cccc(C(F)(F)F)c4)[nH]c23)c1 |
| InChI | InChI=1S/C26H20F3N3O/c27-26(28,29)21-9-1-5-17(13-21)14-22-16-19-7-3-10-23(24(19)32-22)18-6-2-8-20(15-18)25(33)31-12-4-11-30/h1-3,5-10,13,15-16,32H,4,12,14H2,(H,31,33) |
| InChIKey | OQTXYYMNZDADOO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|