C26H23F3N2O4S — CID 59194056
N-[2-(methanesulfonamido)ethyl]-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-4-yl]benzamide (PubChem CID 59194056) has the molecular formula C26H23F3N2O4S and a molecular weight of 516.54 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-4-yl]benzamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-4-yl]benzamide |
|---|---|
| PubChem CID | 59194056 |
| Molecular Formula | C26H23F3N2O4S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-4-yl]benzamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1cccc(-c2cccc3oc(Cc4cccc(C(F)(F)F)c4)cc23)c1 |
| InChI | InChI=1S/C26H23F3N2O4S/c1-36(33,34)31-12-11-30-25(32)19-7-3-6-18(15-19)22-9-4-10-24-23(22)16-21(35-24)14-17-5-2-8-20(13-17)26(27,28)29/h2-10,13,15-16,31H,11-12,14H2,1H3,(H,30,32) |
| InChIKey | AVPMUVKLWGGXGK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|